C23H23N3O4S — CID 126481823
[10-(1,3-benzothiazole-6-carbonyl)-4-hydroxy-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl] N,N-dimethylcarbamate (PubChem CID 126481823) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is [10-(1,3-benzothiazole-6-carbonyl)-4-hydroxy-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl] N,N-dimethylcarbamate.
| Compound Name | [10-(1,3-benzothiazole-6-carbonyl)-4-hydroxy-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 126481823 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [10-(1,3-benzothiazole-6-carbonyl)-4-hydroxy-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC12CCN(C(=O)c3ccc4ncsc4c3)C(Cc3ccc(O)cc31)C2 |
| InChI | InChI=1S/C23H23N3O4S/c1-25(2)22(29)30-23-7-8-26(16(12-23)9-14-3-5-17(27)11-18(14)23)21(28)15-4-6-19-20(10-15)31-13-24-19/h3-6,10-11,13,16,27H,7-9,12H2,1-2H3 |
| InChIKey | JVCWZRHEJYPRTE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |