About methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate
methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate (PubChem CID 126482279) has the molecular formula C9H9ClO4
and a molecular weight of 216.62 g/mol. Its IUPAC name is methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate.
Molecular Properties
| Compound Name | methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate |
| PubChem CID | 126482279 |
| Molecular Formula | C9H9ClO4 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate |
| SMILES | COC(=O)c1cc(Cl)c(O)c(O)c1C |
| InChI | InChI=1S/C9H9ClO4/c1-4-5(9(13)14-2)3-6(10)8(12)7(4)11/h3,11-12H,1-2H3 |
| InChIKey | DRIFJUQEJLRZPK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate?
The IUPAC name of methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate (CID 126482279) is methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate.
What is the SMILES notation for methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate?
The canonical SMILES for methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate is COC(=O)c1cc(Cl)c(O)c(O)c1C.
What is the InChIKey of methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate?
The InChIKey is DRIFJUQEJLRZPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO4/c1-4-5(9(13)14-2)3-6(10)8(12)7(4)11/h3,11-12H,1-2H3.
What are the key properties of methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate?
methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate has a molecular weight of 216.62 g/mol, XLogP of 1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chloro-3,4-dihydroxy-2-methylbenzoate is sourced from PubChem (CID 126482279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).