C29H45N3O4 — CID 126482286
(1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperazin-1-yl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 126482286) has the molecular formula C29H45N3O4 and a molecular weight of 499.70 g/mol. Its IUPAC name is (1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperazin-1-yl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperazin-1-yl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 126482286 |
| Molecular Formula | C29H45N3O4 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | (1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]piperazin-1-yl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | COCCOCCOCCN1CCN(c2ccc3c(c2)[C@]2(C)CCN(CC4CC4)[C@H](C3=O)[C@@H]2C)CC1 |
| InChI | InChI=1S/C29H45N3O4/c1-22-27-28(33)25-7-6-24(20-26(25)29(22,2)8-9-32(27)21-23-4-5-23)31-12-10-30(11-13-31)14-15-35-18-19-36-17-16-34-3/h6-7,20,22-23,27H,4-5,8-19,21H2,1-3H3/t22-,27-,29+/m0/s1 |
| InChIKey | LZCOSDXSQQIXQB-DETITRACSA-N |
| XLogP | 3.06 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|