C20H29N3O5 — CID 126482730
(2S)-2-[[4-[(4-methoxybenzoyl)amino]piperidine-1-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 126482730) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2S)-2-[[4-[(4-methoxybenzoyl)amino]piperidine-1-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[4-[(4-methoxybenzoyl)amino]piperidine-1-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 126482730 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (2S)-2-[[4-[(4-methoxybenzoyl)amino]piperidine-1-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccc(C(=O)NC2CCN(C(=O)N[C@@H](CC(C)C)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-13(2)12-17(19(25)26)22-20(27)23-10-8-15(9-11-23)21-18(24)14-4-6-16(28-3)7-5-14/h4-7,13,15,17H,8-12H2,1-3H3,(H,21,24)(H,22,27)(H,25,26)/t17-/m0/s1 |
| InChIKey | HNNRHCJDWCSTGM-KRWDZBQOSA-N |
| XLogP | 2.10 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |