About 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride
2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride (PubChem CID 126482939) has the molecular formula C19H27ClN2O3
and a molecular weight of 366.89 g/mol. Its IUPAC name is 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride |
| PubChem CID | 126482939 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride |
| SMILES | Cl.Cn1cc(C[C@@H](N)C(=O)OCCC2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C19H26N2O3.ClH/c1-21-13-15(16-4-2-3-5-18(16)21)12-17(20)19(22)24-11-8-14-6-9-23-10-7-14;/h2-5,13-14,17H,6-12,20H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | TZDLRIMABIOWAF-UNTBIKODSA-N |
| XLogP | 2.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
The IUPAC name of 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride (CID 126482939) is 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride.
What is the SMILES notation for 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
The canonical SMILES for 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride is Cl.Cn1cc(C[C@@H](N)C(=O)OCCC2CCOCC2)c2ccccc21.
What is the InChIKey of 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
The InChIKey is TZDLRIMABIOWAF-UNTBIKODSA-N. The full InChI is InChI=1S/C19H26N2O3.ClH/c1-21-13-15(16-4-2-3-5-18(16)21)12-17(20)19(22)24-11-8-14-6-9-23-10-7-14;/h2-5,13-14,17H,6-12,20H2,1H3;1H/t17-;/m1./s1.
What are the key properties of 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride has a molecular weight of 366.89 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)ethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride is sourced from PubChem (CID 126482939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).