C28H42N4O7 — CID 126483043
(2R)-2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid (PubChem CID 126483043) has the molecular formula C28H42N4O7 and a molecular weight of 546.67 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 126483043 |
| Molecular Formula | C28H42N4O7 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (2R)-2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1-methylindol-3-yl)propanoic acid |
| SMILES | Cn1cc(C[C@@H](NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C28H42N4O7/c1-27(2,3)38-25(36)29-15-11-10-13-20(31-26(37)39-28(4,5)6)23(33)30-21(24(34)35)16-18-17-32(7)22-14-9-8-12-19(18)22/h8-9,12,14,17,20-21H,10-11,13,15-16H2,1-7H3,(H,29,36)(H,30,33)(H,31,37)(H,34,35)/t20-,21+/m0/s1 |
| InChIKey | DIWKWDFFYSDJPU-LEWJYISDSA-N |
| XLogP | 3.88 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|