C17H25N5O4 — CID 126483046
methyl (2S)-4-methyl-2-[[4-(pyrazine-2-carbonyl)piperazine-1-carbonyl]amino]pentanoate (PubChem CID 126483046) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[4-(pyrazine-2-carbonyl)piperazine-1-carbonyl]amino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[4-(pyrazine-2-carbonyl)piperazine-1-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 126483046 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[4-(pyrazine-2-carbonyl)piperazine-1-carbonyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)N1CCN(C(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C17H25N5O4/c1-12(2)10-13(16(24)26-3)20-17(25)22-8-6-21(7-9-22)15(23)14-11-18-4-5-19-14/h4-5,11-13H,6-10H2,1-3H3,(H,20,25)/t13-/m0/s1 |
| InChIKey | AKEDIPNBNZJJDP-ZDUSSCGKSA-N |
| XLogP | 0.53 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |