C24H26N2O6 — CID 126483406
(E)-2,3-bis[(2R)-2-benzamidopropyl]but-2-enedioic acid (PubChem CID 126483406) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is (E)-2,3-bis[(2R)-2-benzamidopropyl]but-2-enedioic acid.
| Compound Name | (E)-2,3-bis[(2R)-2-benzamidopropyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 126483406 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (E)-2,3-bis[(2R)-2-benzamidopropyl]but-2-enedioic acid |
| SMILES | C[C@H](C/C(C(=O)O)=C(/C[C@@H](C)NC(=O)c1ccccc1)C(=O)O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O6/c1-15(25-21(27)17-9-5-3-6-10-17)13-19(23(29)30)20(24(31)32)14-16(2)26-22(28)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)(H,31,32)/b20-19+/t15-,16-/m1/s1 |
| InChIKey | DMDJROHJUAWYKT-KZLHXAFESA-N |
| XLogP | 2.87 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|