About N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide
N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide (PubChem CID 126483512) has the molecular formula C23H41N3O5
and a molecular weight of 439.60 g/mol. Its IUPAC name is N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide.
Molecular Properties
| Compound Name | N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide |
| PubChem CID | 126483512 |
| Molecular Formula | C23H41N3O5 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide |
| SMILES | CNC(=O)C(=O)NCCCC/C=C\CCCCCCCOCC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C23H41N3O5/c1-24-22(28)23(29)25-15-11-9-7-5-3-2-4-6-8-10-12-16-31-19-21(27)26-20-13-17-30-18-14-20/h3,5,20H,2,4,6-19H2,1H3,(H,24,28)(H,25,29)(H,26,27)/b5-3- |
| InChIKey | DSWIXTCDSILVPX-HYXAFXHYSA-N |
| XLogP | 2.23 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide?
The IUPAC name of N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide (CID 126483512) is N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide.
What is the SMILES notation for N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide?
The canonical SMILES for N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide is CNC(=O)C(=O)NCCCC/C=C\CCCCCCCOCC(=O)NC1CCOCC1.
What is the InChIKey of N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide?
The InChIKey is DSWIXTCDSILVPX-HYXAFXHYSA-N. The full InChI is InChI=1S/C23H41N3O5/c1-24-22(28)23(29)25-15-11-9-7-5-3-2-4-6-8-10-12-16-31-19-21(27)26-20-13-17-30-18-14-20/h3,5,20H,2,4,6-19H2,1H3,(H,24,28)(H,25,29)(H,26,27)/b5-3-.
What are the key properties of N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide?
N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide has a molecular weight of 439.60 g/mol, XLogP of 2.23, 16 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[(Z)-13-[2-(oxan-4-ylamino)-2-oxoethoxy]tridec-5-enyl]oxamide is sourced from PubChem (CID 126483512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).