About 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide
2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide (PubChem CID 126483661) has the molecular formula C8H10F2N2OS
and a molecular weight of 220.24 g/mol. Its IUPAC name is 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide |
| PubChem CID | 126483661 |
| Molecular Formula | C8H10F2N2OS |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide |
| SMILES | CN(C)NC(=O)c1ccsc1C(F)F |
| InChI | InChI=1S/C8H10F2N2OS/c1-12(2)11-8(13)5-3-4-14-6(5)7(9)10/h3-4,7H,1-2H3,(H,11,13) |
| InChIKey | SRKTWPGUTRBHBG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide?
The IUPAC name of 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide (CID 126483661) is 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide.
What is the SMILES notation for 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide?
The canonical SMILES for 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide is CN(C)NC(=O)c1ccsc1C(F)F.
What is the InChIKey of 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide?
The InChIKey is SRKTWPGUTRBHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2OS/c1-12(2)11-8(13)5-3-4-14-6(5)7(9)10/h3-4,7H,1-2H3,(H,11,13).
What are the key properties of 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide?
2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide has a molecular weight of 220.24 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-N',N'-dimethylthiophene-3-carbohydrazide is sourced from PubChem (CID 126483661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).