About 5-bromo-2-methylphenol
5-bromo-2-methylphenol (PubChem CID 12648404) has the molecular formula C7H7BrO
and a molecular weight of 187.04 g/mol. Its IUPAC name is 5-bromo-2-methylphenol.
Molecular Properties
| Compound Name | 5-bromo-2-methylphenol |
| PubChem CID | 12648404 |
| Molecular Formula | C7H7BrO |
| Molecular Weight | 187.04 g/mol |
| Exact Mass | 185.97 |
| IUPAC Name | 5-bromo-2-methylphenol |
| SMILES | Cc1ccc(Br)cc1O |
| InChI | InChI=1S/C7H7BrO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3 |
| InChIKey | OONJCAWRVJDVBB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.04 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methylphenol?
The IUPAC name of 5-bromo-2-methylphenol (CID 12648404) is 5-bromo-2-methylphenol.
What is the SMILES notation for 5-bromo-2-methylphenol?
The canonical SMILES for 5-bromo-2-methylphenol is Cc1ccc(Br)cc1O.
What is the InChIKey of 5-bromo-2-methylphenol?
The InChIKey is OONJCAWRVJDVBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3.
What are the key properties of 5-bromo-2-methylphenol?
5-bromo-2-methylphenol has a molecular weight of 187.04 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methylphenol is sourced from PubChem (CID 12648404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).