About 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone
1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone (PubChem CID 126484044) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone.
Molecular Properties
| Compound Name | 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone |
| PubChem CID | 126484044 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(C(C)(F)F)nc1 |
| InChI | InChI=1S/C9H9F2NO/c1-6(13)7-3-4-8(12-5-7)9(2,10)11/h3-5H,1-2H3 |
| InChIKey | DWCCUZBFAZTRGX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone?
The IUPAC name of 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone (CID 126484044) is 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone.
What is the SMILES notation for 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone?
The canonical SMILES for 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone is CC(=O)c1ccc(C(C)(F)F)nc1.
What is the InChIKey of 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone?
The InChIKey is DWCCUZBFAZTRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c1-6(13)7-3-4-8(12-5-7)9(2,10)11/h3-5H,1-2H3.
What are the key properties of 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone?
1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone has a molecular weight of 185.17 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(1,1-difluoroethyl)-3-pyridinyl]ethanone is sourced from PubChem (CID 126484044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).