About 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine
6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 126484121) has the molecular formula C15H10BrF3O2
and a molecular weight of 359.14 g/mol. Its IUPAC name is 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 126484121 |
| Molecular Formula | C15H10BrF3O2 |
| Molecular Weight | 359.14 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | FC(F)(F)c1ccc(C2COc3cc(Br)ccc3O2)cc1 |
| InChI | InChI=1S/C15H10BrF3O2/c16-11-5-6-12-13(7-11)20-8-14(21-12)9-1-3-10(4-2-9)15(17,18)19/h1-7,14H,8H2 |
| InChIKey | RPSHKKVRSCVQOR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.14 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine (CID 126484121) is 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine is FC(F)(F)c1ccc(C2COc3cc(Br)ccc3O2)cc1.
What is the InChIKey of 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine?
The InChIKey is RPSHKKVRSCVQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrF3O2/c16-11-5-6-12-13(7-11)20-8-14(21-12)9-1-3-10(4-2-9)15(17,18)19/h1-7,14H,8H2.
What are the key properties of 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine?
6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine has a molecular weight of 359.14 g/mol, XLogP of 4.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 126484121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).