C25H28N8O3S — CID 126484258
N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[[2-(6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide (PubChem CID 126484258) has the molecular formula C25H28N8O3S and a molecular weight of 520.62 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[[2-(6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide.
| Compound Name | N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[[2-(6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126484258 |
| Molecular Formula | C25H28N8O3S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[[2-(6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide |
| SMILES | Cc1cccc(-c2nc(Nc3ccncc3C(=O)NCCCN3CCS(=O)(=O)CC3)c3cccn3n2)n1 |
| InChI | InChI=1S/C25H28N8O3S/c1-18-5-2-6-21(28-18)23-30-24(22-7-3-12-33(22)31-23)29-20-8-10-26-17-19(20)25(34)27-9-4-11-32-13-15-37(35,36)16-14-32/h2-3,5-8,10,12,17H,4,9,11,13-16H2,1H3,(H,27,34)(H,26,29,30,31) |
| InChIKey | BVTYIRKITDNRAI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|