C24H24F3N7O2 — CID 126484356
N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]-2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 126484356) has the molecular formula C24H24F3N7O2 and a molecular weight of 499.50 g/mol. Its IUPAC name is N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]-2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]-2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 126484356 |
| Molecular Formula | C24H24F3N7O2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]-2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | FC(F)(F)c1cccc(-c2nc(Nc3ccncc3OCCCN3CCOCC3)c3cccn3n2)n1 |
| InChI | InChI=1S/C24H24F3N7O2/c25-24(26,27)21-6-1-4-18(29-21)22-31-23(19-5-2-10-34(19)32-22)30-17-7-8-28-16-20(17)36-13-3-9-33-11-14-35-15-12-33/h1-2,4-8,10,16H,3,9,11-15H2,(H,28,30,31,32) |
| InChIKey | LWQDUHGIWGBCPL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|