C18H14FN7O — CID 126484377
N-[4-[[2-(6-fluoro-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2-pyridinyl]acetamide (PubChem CID 126484377) has the molecular formula C18H14FN7O and a molecular weight of 363.36 g/mol. Its IUPAC name is N-[4-[[2-(6-fluoro-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[[2-(6-fluoro-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 126484377 |
| Molecular Formula | C18H14FN7O |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[4-[[2-(6-fluoro-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(Nc2nc(-c3cccc(F)n3)nn3cccc23)ccn1 |
| InChI | InChI=1S/C18H14FN7O/c1-11(27)21-16-10-12(7-8-20-16)22-18-14-5-3-9-26(14)25-17(24-18)13-4-2-6-15(19)23-13/h2-10H,1H3,(H2,20,21,22,24,25,27) |
| InChIKey | GBOJIFPLPDQYNY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|