C19H16N6O — CID 126484464
N-(3-prop-2-enoxy-4-pyridinyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 126484464) has the molecular formula C19H16N6O and a molecular weight of 344.38 g/mol. Its IUPAC name is N-(3-prop-2-enoxy-4-pyridinyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-(3-prop-2-enoxy-4-pyridinyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 126484464 |
| Molecular Formula | C19H16N6O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-(3-prop-2-enoxy-4-pyridinyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C=CCOc1cnccc1Nc1nc(-c2ccccn2)nn2cccc12 |
| InChI | InChI=1S/C19H16N6O/c1-2-12-26-17-13-20-10-8-14(17)22-19-16-7-5-11-25(16)24-18(23-19)15-6-3-4-9-21-15/h2-11,13H,1,12H2,(H,20,22,23,24) |
| InChIKey | GUBWWEPNZCJLMM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|