About ethoxyethane;2-(2-phenylpropan-2-yl)phenol
ethoxyethane;2-(2-phenylpropan-2-yl)phenol (PubChem CID 126484848) has the molecular formula C19H26O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is ethoxyethane;2-(2-phenylpropan-2-yl)phenol.
Molecular Properties
| Compound Name | ethoxyethane;2-(2-phenylpropan-2-yl)phenol |
| PubChem CID | 126484848 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | ethoxyethane;2-(2-phenylpropan-2-yl)phenol |
| SMILES | CC(C)(c1ccccc1)c1ccccc1O.CCOCC |
| InChI | InChI=1S/C15H16O.C4H10O/c1-15(2,12-8-4-3-5-9-12)13-10-6-7-11-14(13)16;1-3-5-4-2/h3-11,16H,1-2H3;3-4H2,1-2H3 |
| InChIKey | SXGZIASQSIFMJM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethoxyethane;2-(2-phenylpropan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;2-(2-phenylpropan-2-yl)phenol?
The IUPAC name of ethoxyethane;2-(2-phenylpropan-2-yl)phenol (CID 126484848) is ethoxyethane;2-(2-phenylpropan-2-yl)phenol.
What is the SMILES notation for ethoxyethane;2-(2-phenylpropan-2-yl)phenol?
The canonical SMILES for ethoxyethane;2-(2-phenylpropan-2-yl)phenol is CC(C)(c1ccccc1)c1ccccc1O.CCOCC.
What is the InChIKey of ethoxyethane;2-(2-phenylpropan-2-yl)phenol?
The InChIKey is SXGZIASQSIFMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O.C4H10O/c1-15(2,12-8-4-3-5-9-12)13-10-6-7-11-14(13)16;1-3-5-4-2/h3-11,16H,1-2H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;2-(2-phenylpropan-2-yl)phenol?
ethoxyethane;2-(2-phenylpropan-2-yl)phenol has a molecular weight of 286.42 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;2-(2-phenylpropan-2-yl)phenol is sourced from PubChem (CID 126484848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).