C10H12OS — CID 12648557
7,7-dimethyl-5,6-dihydro-1-benzothiophen-4-one (PubChem CID 12648557) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 7,7-dimethyl-5,6-dihydro-1-benzothiophen-4-one.
| Compound Name | 7,7-dimethyl-5,6-dihydro-1-benzothiophen-4-one |
|---|---|
| PubChem CID | 12648557 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 7,7-dimethyl-5,6-dihydro-1-benzothiophen-4-one |
| SMILES | CC1(C)CCC(=O)c2ccsc21 |
| InChI | InChI=1S/C10H12OS/c1-10(2)5-3-8(11)7-4-6-12-9(7)10/h4,6H,3,5H2,1-2H3 |
| InChIKey | FPRZFRCXVFHNIE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |