C26H28N5OPS — CID 126486321
N-[4-(3-aminopiperidin-1-yl)quinolin-3-yl]-5-methyl-2-(2-methyl-6-phosphanylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 126486321) has the molecular formula C26H28N5OPS and a molecular weight of 489.59 g/mol. Its IUPAC name is N-[4-(3-aminopiperidin-1-yl)quinolin-3-yl]-5-methyl-2-(2-methyl-6-phosphanylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(3-aminopiperidin-1-yl)quinolin-3-yl]-5-methyl-2-(2-methyl-6-phosphanylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126486321 |
| Molecular Formula | C26H28N5OPS |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[4-(3-aminopiperidin-1-yl)quinolin-3-yl]-5-methyl-2-(2-methyl-6-phosphanylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cccc(P)c1-c1nc(C(=O)Nc2cnc3ccccc3c2N2CCCC(N)C2)c(C)s1 |
| InChI | InChI=1S/C26H28N5OPS/c1-15-7-5-11-21(33)22(15)26-30-23(16(2)34-26)25(32)29-20-13-28-19-10-4-3-9-18(19)24(20)31-12-6-8-17(27)14-31/h3-5,7,9-11,13,17H,6,8,12,14,27,33H2,1-2H3,(H,29,32) |
| InChIKey | HACNSFPCJSZUSW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|