C30H44O7 — CID 126486698
[(1S,7R,11S,14S,15R,16R)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-2-oxapentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dien-14-yl] decanoate (PubChem CID 126486698) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is [(1S,7R,11S,14S,15R,16R)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-2-oxapentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dien-14-yl] decanoate.
| Compound Name | [(1S,7R,11S,14S,15R,16R)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-2-oxapentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dien-14-yl] decanoate |
|---|---|
| PubChem CID | 126486698 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [(1S,7R,11S,14S,15R,16R)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-2-oxapentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dien-14-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@]12C([C@@H]3C=C(CO)C[C@]4(O)C(=O)C(C)=CC45O[C@]35[C@H](C)[C@H]1O)C2(C)C |
| InChI | InChI=1S/C30H44O7/c1-6-7-8-9-10-11-12-13-22(32)36-30-23(26(30,4)5)21-14-20(17-31)16-27(35)24(33)18(2)15-28(27)29(21,37-28)19(3)25(30)34/h14-15,19,21,23,25,31,34-35H,6-13,16-17H2,1-5H3/t19-,21+,23?,25-,27+,28?,29-,30-/m1/s1 |
| InChIKey | GADYJUWBTCZQDB-YXNDBJOISA-N |
| XLogP | 3.78 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|