C28H29F2N3O6S — CID 126487074
1-(1,3-benzodioxol-5-yl)-N-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)-[[(2R)-1-hydroxy-4-methylpentan-2-yl]amino]methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 126487074) has the molecular formula C28H29F2N3O6S and a molecular weight of 573.62 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)-[[(2R)-1-hydroxy-4-methylpentan-2-yl]amino]methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)-[[(2R)-1-hydroxy-4-methylpentan-2-yl]amino]methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 126487074 |
| Molecular Formula | C28H29F2N3O6S |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[5-[(2,2-difluoro-1,3-benzodioxol-4-yl)-[[(2R)-1-hydroxy-4-methylpentan-2-yl]amino]methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)C[C@H](CO)NC(c1cnc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)s1)c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C28H29F2N3O6S/c1-15(2)10-17(13-34)32-23(18-4-3-5-20-24(18)39-28(29,30)38-20)22-12-31-26(40-22)33-25(35)27(8-9-27)16-6-7-19-21(11-16)37-14-36-19/h3-7,11-12,15,17,23,32,34H,8-10,13-14H2,1-2H3,(H,31,33,35)/t17-,23?/m1/s1 |
| InChIKey | ABGNUCHRCIWBOE-LIXIDFRTSA-N |
| XLogP | 4.95 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |