C37H36F12O6 — CID 126487245
[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-(3-methylpentan-3-yloxy)phenyl]phenyl] 3-(2-ethylbutanoyl)benzoate (PubChem CID 126487245) has the molecular formula C37H36F12O6 and a molecular weight of 804.66 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-(3-methylpentan-3-yloxy)phenyl]phenyl] 3-(2-ethylbutanoyl)benzoate.
| Compound Name | [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-(3-methylpentan-3-yloxy)phenyl]phenyl] 3-(2-ethylbutanoyl)benzoate |
|---|---|
| PubChem CID | 126487245 |
| Molecular Formula | C37H36F12O6 |
| Molecular Weight | 804.66 g/mol |
| Exact Mass | 804.23 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-(3-methylpentan-3-yloxy)phenyl]phenyl] 3-(2-ethylbutanoyl)benzoate |
| SMILES | CCC(CC)C(=O)c1cccc(C(=O)Oc2ccc(-c3ccc(OC(C)(CC)CC)c(C(O)(C(F)(F)F)C(F)(F)F)c3)cc2C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C37H36F12O6/c1-6-20(7-2)29(50)23-11-10-12-24(17-23)30(51)54-27-15-13-21(18-25(27)32(52,34(38,39)40)35(41,42)43)22-14-16-28(55-31(5,8-3)9-4)26(19-22)33(53,36(44,45)46)37(47,48)49/h10-20,52-53H,6-9H2,1-5H3 |
| InChIKey | LSPYNRMRRBYPPX-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.66 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|