C13H20F6N4O12S3 — CID 126487801
3-[2-[bis[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethyl]amino]ethylamino]-2,2-difluoro-3-oxopropane-1-sulfonic acid (PubChem CID 126487801) has the molecular formula C13H20F6N4O12S3 and a molecular weight of 634.51 g/mol. Its IUPAC name is 3-[2-[bis[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethyl]amino]ethylamino]-2,2-difluoro-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-[2-[bis[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethyl]amino]ethylamino]-2,2-difluoro-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 126487801 |
| Molecular Formula | C13H20F6N4O12S3 |
| Molecular Weight | 634.51 g/mol |
| Exact Mass | 634.01 |
| IUPAC Name | 3-[2-[bis[2-[(2,2-difluoro-2-sulfoacetyl)amino]ethyl]amino]ethylamino]-2,2-difluoro-3-oxopropane-1-sulfonic acid |
| SMILES | O=C(NCCN(CCNC(=O)C(F)(F)S(=O)(=O)O)CCNC(=O)C(F)(F)S(=O)(=O)O)C(F)(F)CS(=O)(=O)O |
| InChI | InChI=1S/C13H20F6N4O12S3/c14-11(15,7-36(27,28)29)8(24)20-1-4-23(5-2-21-9(25)12(16,17)37(30,31)32)6-3-22-10(26)13(18,19)38(33,34)35/h1-7H2,(H,20,24)(H,21,25)(H,22,26)(H,27,28,29)(H,30,31,32)(H,33,34,35) |
| InChIKey | BIMRDPKDVIETSP-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 253.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.51 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|