C19H17ClN4 — CID 126487838
4-chloro-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methyl-5-phenylpyrazolo[3,4-c]pyridazine (PubChem CID 126487838) has the molecular formula C19H17ClN4 and a molecular weight of 336.83 g/mol. Its IUPAC name is 4-chloro-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methyl-5-phenylpyrazolo[3,4-c]pyridazine.
| Compound Name | 4-chloro-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methyl-5-phenylpyrazolo[3,4-c]pyridazine |
|---|---|
| PubChem CID | 126487838 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-chloro-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methyl-5-phenylpyrazolo[3,4-c]pyridazine |
| SMILES | C=C/C=C\C(=C/C)c1nn(C)c2nnc(-c3ccccc3)c(Cl)c12 |
| InChI | InChI=1S/C19H17ClN4/c1-4-6-10-13(5-2)17-15-16(20)18(14-11-8-7-9-12-14)21-22-19(15)24(3)23-17/h4-12H,1H2,2-3H3/b10-6-,13-5+ |
| InChIKey | XYKFAHMYEUZZLK-GXUPAZJSSA-N |
| XLogP | 4.83 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|