About N,N-dimethylnonan-5-amine
N,N-dimethylnonan-5-amine (PubChem CID 12648799) has the molecular formula C11H25N
and a molecular weight of 171.33 g/mol. Its IUPAC name is N,N-dimethylnonan-5-amine.
Molecular Properties
| Compound Name | N,N-dimethylnonan-5-amine |
| PubChem CID | 12648799 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | N,N-dimethylnonan-5-amine |
| SMILES | CCCCC(CCCC)N(C)C |
| InChI | InChI=1S/C11H25N/c1-5-7-9-11(12(3)4)10-8-6-2/h11H,5-10H2,1-4H3 |
| InChIKey | AQYCMONYNQCWAQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylnonan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylnonan-5-amine?
The IUPAC name of N,N-dimethylnonan-5-amine (CID 12648799) is N,N-dimethylnonan-5-amine.
What is the SMILES notation for N,N-dimethylnonan-5-amine?
The canonical SMILES for N,N-dimethylnonan-5-amine is CCCCC(CCCC)N(C)C.
What is the InChIKey of N,N-dimethylnonan-5-amine?
The InChIKey is AQYCMONYNQCWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N/c1-5-7-9-11(12(3)4)10-8-6-2/h11H,5-10H2,1-4H3.
What are the key properties of N,N-dimethylnonan-5-amine?
N,N-dimethylnonan-5-amine has a molecular weight of 171.33 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylnonan-5-amine is sourced from PubChem (CID 12648799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).