C23H22F3N5O2S — CID 126488434
[(1S,5S)-3-amino-5-[2,3-difluoro-5-[(5-fluoro-3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-5,7-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol (PubChem CID 126488434) has the molecular formula C23H22F3N5O2S and a molecular weight of 489.52 g/mol. Its IUPAC name is [(1S,5S)-3-amino-5-[2,3-difluoro-5-[(5-fluoro-3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-5,7-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol.
| Compound Name | [(1S,5S)-3-amino-5-[2,3-difluoro-5-[(5-fluoro-3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-5,7-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 126488434 |
| Molecular Formula | C23H22F3N5O2S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [(1S,5S)-3-amino-5-[2,3-difluoro-5-[(5-fluoro-3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-5,7-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol |
| SMILES | COc1cnc2c(Nc3cc(F)c(F)c([C@@]4(C)N=C(N)S[C@@]5(CO)C(C)C54)c3)ncc(F)c2c1 |
| InChI | InChI=1S/C23H22F3N5O2S/c1-10-19-22(2,31-21(27)34-23(10,19)9-32)14-4-11(5-15(24)17(14)26)30-20-18-13(16(25)8-29-20)6-12(33-3)7-28-18/h4-8,10,19,32H,9H2,1-3H3,(H2,27,31)(H,29,30)/t10?,19?,22-,23+/m1/s1 |
| InChIKey | VERKZPZJNGUVQL-SKFWVKESSA-N |
| XLogP | 4.07 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |