About (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one
(6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (PubChem CID 12648866) has the molecular formula C7H10O2
and a molecular weight of 126.16 g/mol. Its IUPAC name is (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
Analyze (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one?
The IUPAC name of (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (CID 12648866) is (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
What is the SMILES notation for (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one?
The canonical SMILES for (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one is O=C1OC[C@H]2CCCC12.
What is the InChIKey of (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one?
The InChIKey is WAWXKXJCQYNDFY-LWOQYNTDSA-N. The full InChI is InChI=1S/C7H10O2/c8-7-6-3-1-2-5(6)4-9-7/h5-6H,1-4H2/t5-,6?/m1/s1.
What are the key properties of (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one?
(6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one has a molecular weight of 126.16 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6aS)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one is sourced from PubChem (CID 12648866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).