About 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one
1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one (PubChem CID 126488737) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one |
| PubChem CID | 126488737 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one |
| SMILES | C=C/C=C(\C=C)N1CCCC1=O |
| InChI | InChI=1S/C10H13NO/c1-3-6-9(4-2)11-8-5-7-10(11)12/h3-4,6H,1-2,5,7-8H2/b9-6+ |
| InChIKey | BDDZTIXFGDUIKC-RMKNXTFCSA-N |
| XLogP | 1.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one?
The IUPAC name of 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one (CID 126488737) is 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one?
The canonical SMILES for 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one is C=C/C=C(\C=C)N1CCCC1=O.
What is the InChIKey of 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one?
The InChIKey is BDDZTIXFGDUIKC-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H13NO/c1-3-6-9(4-2)11-8-5-7-10(11)12/h3-4,6H,1-2,5,7-8H2/b9-6+.
What are the key properties of 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one?
1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one has a molecular weight of 163.22 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-hexa-1,3,5-trien-3-yl]pyrrolidin-2-one is sourced from PubChem (CID 126488737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).