C23H24F2N6O3S2 — CID 126488869
N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-(1,3-thiazol-2-ylmethoxy)pyrazine-2-carboxamide (PubChem CID 126488869) has the molecular formula C23H24F2N6O3S2 and a molecular weight of 534.61 g/mol. Its IUPAC name is N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-(1,3-thiazol-2-ylmethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-(1,3-thiazol-2-ylmethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126488869 |
| Molecular Formula | C23H24F2N6O3S2 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-(1,3-thiazol-2-ylmethoxy)pyrazine-2-carboxamide |
| SMILES | COC[C@@]1(C)C[C@@](C)(c2cc(NC(=O)c3cnc(OCc4nccs4)cn3)cc(F)c2F)N=C(N)S1 |
| InChI | InChI=1S/C23H24F2N6O3S2/c1-22(12-33-3)11-23(2,31-21(26)36-22)14-6-13(7-15(24)19(14)25)30-20(32)16-8-29-17(9-28-16)34-10-18-27-4-5-35-18/h4-9H,10-12H2,1-3H3,(H2,26,31)(H,30,32)/t22-,23+/m1/s1 |
| InChIKey | ALVWMSFWOXSING-PKTZIBPZSA-N |
| XLogP | 4.11 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |