C12H14N2O4 — CID 126489188
(3aR)-8-methoxy-1,3,3a,10-tetrahydro-[1,3]oxazolo[4,3-c][1,4]benzodiazepine-7,10-diol (PubChem CID 126489188) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (3aR)-8-methoxy-1,3,3a,10-tetrahydro-[1,3]oxazolo[4,3-c][1,4]benzodiazepine-7,10-diol.
| Compound Name | (3aR)-8-methoxy-1,3,3a,10-tetrahydro-[1,3]oxazolo[4,3-c][1,4]benzodiazepine-7,10-diol |
|---|---|
| PubChem CID | 126489188 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3aR)-8-methoxy-1,3,3a,10-tetrahydro-[1,3]oxazolo[4,3-c][1,4]benzodiazepine-7,10-diol |
| SMILES | COc1cc2c(cc1O)N=C[C@@H]1COCN1C2O |
| InChI | InChI=1S/C12H14N2O4/c1-17-11-2-8-9(3-10(11)15)13-4-7-5-18-6-14(7)12(8)16/h2-4,7,12,15-16H,5-6H2,1H3/t7-,12?/m1/s1 |
| InChIKey | WWFNCNSKEQAJRW-OJYJAAIMSA-N |
| XLogP | 0.77 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |