About 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine
7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine (PubChem CID 126489243) has the molecular formula C9H11FN4
and a molecular weight of 194.21 g/mol. Its IUPAC name is 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 126489243 |
| Molecular Formula | C9H11FN4 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(C)n1cnc2c(N)ncc(F)c21 |
| InChI | InChI=1S/C9H11FN4/c1-5(2)14-4-13-7-8(14)6(10)3-12-9(7)11/h3-5H,1-2H3,(H2,11,12) |
| InChIKey | YRWACPYZBKYAGS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine (CID 126489243) is 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine is CC(C)n1cnc2c(N)ncc(F)c21.
What is the InChIKey of 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
The InChIKey is YRWACPYZBKYAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN4/c1-5(2)14-4-13-7-8(14)6(10)3-12-9(7)11/h3-5H,1-2H3,(H2,11,12).
What are the key properties of 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine?
7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine has a molecular weight of 194.21 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-propan-2-ylimidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 126489243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).