C16H25NS — CID 126489843
(Z)-2-[3-(cyclohexen-1-yl)-4,4-dimethyl-1,2,3,5-tetrahydroazepin-7-yl]ethenethiol (PubChem CID 126489843) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is (Z)-2-[3-(cyclohexen-1-yl)-4,4-dimethyl-1,2,3,5-tetrahydroazepin-7-yl]ethenethiol.
| Compound Name | (Z)-2-[3-(cyclohexen-1-yl)-4,4-dimethyl-1,2,3,5-tetrahydroazepin-7-yl]ethenethiol |
|---|---|
| PubChem CID | 126489843 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (Z)-2-[3-(cyclohexen-1-yl)-4,4-dimethyl-1,2,3,5-tetrahydroazepin-7-yl]ethenethiol |
| SMILES | CC1(C)CC=C(/C=C\S)NCC1C1=CCCCC1 |
| InChI | InChI=1S/C16H25NS/c1-16(2)10-8-14(9-11-18)17-12-15(16)13-6-4-3-5-7-13/h6,8-9,11,15,17-18H,3-5,7,10,12H2,1-2H3/b11-9- |
| InChIKey | HAVCZCSMFHRFQE-LUAWRHEFSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|