About 5,5-dimethyl-2H-furan-2,3,4-triol
5,5-dimethyl-2H-furan-2,3,4-triol (PubChem CID 126490027) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 5,5-dimethyl-2H-furan-2,3,4-triol.
Molecular Properties
| Compound Name | 5,5-dimethyl-2H-furan-2,3,4-triol |
| PubChem CID | 126490027 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 5,5-dimethyl-2H-furan-2,3,4-triol |
| SMILES | CC1(C)OC(O)C(O)=C1O |
| InChI | InChI=1S/C6H10O4/c1-6(2)4(8)3(7)5(9)10-6/h5,7-9H,1-2H3 |
| InChIKey | OMMKFXWNYDMDOF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dimethyl-2H-furan-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2H-furan-2,3,4-triol?
The IUPAC name of 5,5-dimethyl-2H-furan-2,3,4-triol (CID 126490027) is 5,5-dimethyl-2H-furan-2,3,4-triol.
What is the SMILES notation for 5,5-dimethyl-2H-furan-2,3,4-triol?
The canonical SMILES for 5,5-dimethyl-2H-furan-2,3,4-triol is CC1(C)OC(O)C(O)=C1O.
What is the InChIKey of 5,5-dimethyl-2H-furan-2,3,4-triol?
The InChIKey is OMMKFXWNYDMDOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-6(2)4(8)3(7)5(9)10-6/h5,7-9H,1-2H3.
What are the key properties of 5,5-dimethyl-2H-furan-2,3,4-triol?
5,5-dimethyl-2H-furan-2,3,4-triol has a molecular weight of 146.14 g/mol, XLogP of 0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2H-furan-2,3,4-triol is sourced from PubChem (CID 126490027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).