C12H15FN2 — CID 126490090
4-fluoro-1-N-[(3E)-hexa-1,3-dien-3-yl]benzene-1,3-diamine (PubChem CID 126490090) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 4-fluoro-1-N-[(3E)-hexa-1,3-dien-3-yl]benzene-1,3-diamine.
| Compound Name | 4-fluoro-1-N-[(3E)-hexa-1,3-dien-3-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 126490090 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-fluoro-1-N-[(3E)-hexa-1,3-dien-3-yl]benzene-1,3-diamine |
| SMILES | C=C/C(=C\CC)Nc1ccc(F)c(N)c1 |
| InChI | InChI=1S/C12H15FN2/c1-3-5-9(4-2)15-10-6-7-11(13)12(14)8-10/h4-8,15H,2-3,14H2,1H3/b9-5+ |
| InChIKey | UCXYJSQYMRYUBX-WEVVVXLNSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|