About 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane
2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane (PubChem CID 126490103) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane.
Molecular Properties
| Compound Name | 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane |
| PubChem CID | 126490103 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane |
| SMILES | C=C(CCC)OCC(CCC(C)(C)C)OC |
| InChI | InChI=1S/C14H28O2/c1-7-8-12(2)16-11-13(15-6)9-10-14(3,4)5/h13H,2,7-11H2,1,3-6H3 |
| InChIKey | HMAZAAMRNBCRBO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane?
The IUPAC name of 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane (CID 126490103) is 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane.
What is the SMILES notation for 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane?
The canonical SMILES for 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane is C=C(CCC)OCC(CCC(C)(C)C)OC.
What is the InChIKey of 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane?
The InChIKey is HMAZAAMRNBCRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-7-8-12(2)16-11-13(15-6)9-10-14(3,4)5/h13H,2,7-11H2,1,3-6H3.
What are the key properties of 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane?
2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane has a molecular weight of 228.38 g/mol, XLogP of 4.16, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5,5-dimethyl-1-pent-1-en-2-yloxyhexane is sourced from PubChem (CID 126490103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).