C23H24F3N3O3 — CID 126490107
N-[4-[[4-(2,2-dihydroxyethyl)-3,5-dimethylpyrazol-1-yl]methyl]phenyl]-4-methyl-2-(trifluoromethyl)benzamide (PubChem CID 126490107) has the molecular formula C23H24F3N3O3 and a molecular weight of 447.46 g/mol. Its IUPAC name is N-[4-[[4-(2,2-dihydroxyethyl)-3,5-dimethylpyrazol-1-yl]methyl]phenyl]-4-methyl-2-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[[4-(2,2-dihydroxyethyl)-3,5-dimethylpyrazol-1-yl]methyl]phenyl]-4-methyl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 126490107 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[4-[[4-(2,2-dihydroxyethyl)-3,5-dimethylpyrazol-1-yl]methyl]phenyl]-4-methyl-2-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Cn3nc(C)c(CC(O)O)c3C)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F3N3O3/c1-13-4-9-18(20(10-13)23(24,25)26)22(32)27-17-7-5-16(6-8-17)12-29-15(3)19(11-21(30)31)14(2)28-29/h4-10,21,30-31H,11-12H2,1-3H3,(H,27,32) |
| InChIKey | RMQZOXINJHACKP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|