C13H21FN2 — CID 126490133
1-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 126490133) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 1-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 126490133 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 1-[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | C=C/C(F)=C(\C=C/C)N1CCC(N(C)C)C1 |
| InChI | InChI=1S/C13H21FN2/c1-5-7-13(12(14)6-2)16-9-8-11(10-16)15(3)4/h5-7,11H,2,8-10H2,1,3-4H3/b7-5-,13-12- |
| InChIKey | HDUWXSHESQZYNB-TXTXDJJGSA-N |
| XLogP | 2.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|