About 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine
4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine (PubChem CID 126490204) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine |
| PubChem CID | 126490204 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine |
| SMILES | COC1=CC(C2CCN(C)CC2)C(C)C=C1C |
| InChI | InChI=1S/C15H25NO/c1-11-9-12(2)15(17-4)10-14(11)13-5-7-16(3)8-6-13/h9-11,13-14H,5-8H2,1-4H3 |
| InChIKey | XPQSRIWCLBFODH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine?
The IUPAC name of 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine (CID 126490204) is 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine.
What is the SMILES notation for 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine?
The canonical SMILES for 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine is COC1=CC(C2CCN(C)CC2)C(C)C=C1C.
What is the InChIKey of 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine?
The InChIKey is XPQSRIWCLBFODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-11-9-12(2)15(17-4)10-14(11)13-5-7-16(3)8-6-13/h9-11,13-14H,5-8H2,1-4H3.
What are the key properties of 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine?
4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine has a molecular weight of 235.37 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxy-4,6-dimethylcyclohexa-2,4-dien-1-yl)-1-methylpiperidine is sourced from PubChem (CID 126490204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).