C8H11N — CID 126490267
N-[(3Z,5Z)-hepta-1,3,5-trien-3-yl]methanimine (PubChem CID 126490267) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is N-[(3Z,5Z)-hepta-1,3,5-trien-3-yl]methanimine.
| Compound Name | N-[(3Z,5Z)-hepta-1,3,5-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 126490267 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | N-[(3Z,5Z)-hepta-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C(=C/C=C\C)N=C |
| InChI | InChI=1S/C8H11N/c1-4-6-7-8(5-2)9-3/h4-7H,2-3H2,1H3/b6-4-,8-7- |
| InChIKey | RULSKPSHZXZJNK-MOIRPGTBSA-N |
| XLogP | 2.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|