About 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol
4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol (PubChem CID 126490332) has the molecular formula C14H16S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol.
Molecular Properties
| Compound Name | 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol |
| PubChem CID | 126490332 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol |
| SMILES | C=C(C(/C=C\C)=C/C)c1ccc(S)cc1 |
| InChI | InChI=1S/C14H16S/c1-4-6-12(5-2)11(3)13-7-9-14(15)10-8-13/h4-10,15H,3H2,1-2H3/b6-4-,12-5+ |
| InChIKey | KQOBYIVOVDDFSN-GLNLJRCCSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol?
The IUPAC name of 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol (CID 126490332) is 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol.
What is the SMILES notation for 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol?
The canonical SMILES for 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol is C=C(C(/C=C\C)=C/C)c1ccc(S)cc1.
What is the InChIKey of 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol?
The InChIKey is KQOBYIVOVDDFSN-GLNLJRCCSA-N. The full InChI is InChI=1S/C14H16S/c1-4-6-12(5-2)11(3)13-7-9-14(15)10-8-13/h4-10,15H,3H2,1-2H3/b6-4-,12-5+.
What are the key properties of 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol?
4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol has a molecular weight of 216.35 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]benzenethiol is sourced from PubChem (CID 126490332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).