C14H21IO — CID 126490434
1-(4-iodo-2,4-dimethylpentan-2-yl)oxy-4-methylbenzene (PubChem CID 126490434) has the molecular formula C14H21IO and a molecular weight of 332.23 g/mol. Its IUPAC name is 1-(4-iodo-2,4-dimethylpentan-2-yl)oxy-4-methylbenzene.
| Compound Name | 1-(4-iodo-2,4-dimethylpentan-2-yl)oxy-4-methylbenzene |
|---|---|
| PubChem CID | 126490434 |
| Molecular Formula | C14H21IO |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-(4-iodo-2,4-dimethylpentan-2-yl)oxy-4-methylbenzene |
| SMILES | Cc1ccc(OC(C)(C)CC(C)(C)I)cc1 |
| InChI | InChI=1S/C14H21IO/c1-11-6-8-12(9-7-11)16-14(4,5)10-13(2,3)15/h6-9H,10H2,1-5H3 |
| InChIKey | BBEYRVHNJKYKRQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|