C15H23NS — CID 126491003
(3E,4E,7Z)-N,5-dimethyl-6-methylidene-8-methylsulfanyl-3-propylideneocta-4,7-dien-2-imine (PubChem CID 126491003) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is (3E,4E,7Z)-N,5-dimethyl-6-methylidene-8-methylsulfanyl-3-propylideneocta-4,7-dien-2-imine.
| Compound Name | (3E,4E,7Z)-N,5-dimethyl-6-methylidene-8-methylsulfanyl-3-propylideneocta-4,7-dien-2-imine |
|---|---|
| PubChem CID | 126491003 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (3E,4E,7Z)-N,5-dimethyl-6-methylidene-8-methylsulfanyl-3-propylideneocta-4,7-dien-2-imine |
| SMILES | C=C(/C=C\SC)/C(C)=C/C(=C\CC)/C(C)=N/C |
| InChI | InChI=1S/C15H23NS/c1-7-8-15(14(4)16-5)11-13(3)12(2)9-10-17-6/h8-11H,2,7H2,1,3-6H3/b10-9-,13-11+,15-8+,16-14+ |
| InChIKey | RKOASHKSLZRQCC-ZAXNODELSA-N |
| XLogP | 4.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|