C19H26N2 — CID 126491160
(3Z,5E,8E,11Z)-3,6,9-trimethyl-2-methylidene-7-methyliminotetradeca-3,5,8,11-tetraenenitrile (PubChem CID 126491160) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (3Z,5E,8E,11Z)-3,6,9-trimethyl-2-methylidene-7-methyliminotetradeca-3,5,8,11-tetraenenitrile.
| Compound Name | (3Z,5E,8E,11Z)-3,6,9-trimethyl-2-methylidene-7-methyliminotetradeca-3,5,8,11-tetraenenitrile |
|---|---|
| PubChem CID | 126491160 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (3Z,5E,8E,11Z)-3,6,9-trimethyl-2-methylidene-7-methyliminotetradeca-3,5,8,11-tetraenenitrile |
| SMILES | C=C(C#N)/C(C)=C\C=C(C)\C(/C=C(\C)C/C=C\CC)=N\C |
| InChI | InChI=1S/C19H26N2/c1-7-8-9-10-15(2)13-19(21-6)17(4)12-11-16(3)18(5)14-20/h8-9,11-13H,5,7,10H2,1-4,6H3/b9-8-,15-13+,16-11-,17-12+,21-19+ |
| InChIKey | XVTNVWOQFCMOAC-WVQJLIGZSA-N |
| XLogP | 5.33 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|