About (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene
(4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene (PubChem CID 126491958) has the molecular formula C25H27N5OS2
and a molecular weight of 477.66 g/mol. Its IUPAC name is (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene.
Molecular Properties
| Compound Name | (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene |
| PubChem CID | 126491958 |
| Molecular Formula | C25H27N5OS2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene |
| SMILES | CCCCOc1ccc(/N=N/c2nc3sc(/N=N/c4ccc(CCCC)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C25H27N5OS2/c1-3-5-7-18-8-10-19(11-9-18)27-29-23-17-22-24(33-23)26-25(32-22)30-28-20-12-14-21(15-13-20)31-16-6-4-2/h8-15,17H,3-7,16H2,1-2H3/b29-27+,30-28+ |
| InChIKey | MAFFUELCIGPPLF-QAVVBOBSSA-N |
| XLogP | 9.71 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene?
The IUPAC name of (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene (CID 126491958) is (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene.
What is the SMILES notation for (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene?
The canonical SMILES for (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene is CCCCOc1ccc(/N=N/c2nc3sc(/N=N/c4ccc(CCCC)cc4)cc3s2)cc1.
What is the InChIKey of (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene?
The InChIKey is MAFFUELCIGPPLF-QAVVBOBSSA-N. The full InChI is InChI=1S/C25H27N5OS2/c1-3-5-7-18-8-10-19(11-9-18)27-29-23-17-22-24(33-23)26-25(32-22)30-28-20-12-14-21(15-13-20)31-16-6-4-2/h8-15,17H,3-7,16H2,1-2H3/b29-27+,30-28+.
What are the key properties of (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene?
(4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene has a molecular weight of 477.66 g/mol, XLogP of 9.71, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxyphenyl)-[5-[(4-butylphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene is sourced from PubChem (CID 126491958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).