About (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene
(5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene (PubChem CID 126492000) has the molecular formula C27H31N5OS2
and a molecular weight of 505.71 g/mol. Its IUPAC name is (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene.
Molecular Properties
| Compound Name | (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene |
| PubChem CID | 126492000 |
| Molecular Formula | C27H31N5OS2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene |
| SMILES | CCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3nc4sc(CCCC)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C27H31N5OS2/c1-3-5-7-8-18-33-23-16-14-22(15-17-23)30-29-20-10-12-21(13-11-20)31-32-27-28-26-25(35-27)19-24(34-26)9-6-4-2/h10-17,19H,3-9,18H2,1-2H3/b30-29+,32-31+ |
| InChIKey | UJQCKTLJLKTDJD-PNBBGTCESA-N |
| XLogP | 10.49 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene?
The IUPAC name of (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene (CID 126492000) is (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene.
What is the SMILES notation for (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene?
The canonical SMILES for (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene is CCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3nc4sc(CCCC)cc4s3)cc2)cc1.
What is the InChIKey of (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene?
The InChIKey is UJQCKTLJLKTDJD-PNBBGTCESA-N. The full InChI is InChI=1S/C27H31N5OS2/c1-3-5-7-8-18-33-23-16-14-22(15-17-23)30-29-20-10-12-21(13-11-20)31-32-27-28-26-25(35-27)19-24(34-26)9-6-4-2/h10-17,19H,3-9,18H2,1-2H3/b30-29+,32-31+.
What are the key properties of (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene?
(5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene has a molecular weight of 505.71 g/mol, XLogP of 10.49, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (5-butylthieno[2,3-d][1,3]thiazol-2-yl)-[4-[(4-hexoxyphenyl)diazenyl]phenyl]diazene is sourced from PubChem (CID 126492000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).