C23H18ClN7O — CID 126492060
2-(6-chloro-3-pyridinyl)-N-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]acetamide (PubChem CID 126492060) has the molecular formula C23H18ClN7O and a molecular weight of 443.90 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-N-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]acetamide.
| Compound Name | 2-(6-chloro-3-pyridinyl)-N-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 126492060 |
| Molecular Formula | C23H18ClN7O |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-N-[4-[6-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]phenyl]acetamide |
| SMILES | Cn1cc(-c2cc3c(-c4ccc(NC(=O)Cc5ccc(Cl)nc5)cc4)ncnn3c2)cn1 |
| InChI | InChI=1S/C23H18ClN7O/c1-30-12-18(11-27-30)17-9-20-23(26-14-28-31(20)13-17)16-3-5-19(6-4-16)29-22(32)8-15-2-7-21(24)25-10-15/h2-7,9-14H,8H2,1H3,(H,29,32) |
| InChIKey | FZLPXEBWGFRKHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|