C4H2BrN7O2 — CID 12649248
3-bromo-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole (PubChem CID 12649248) has the molecular formula C4H2BrN7O2 and a molecular weight of 260.01 g/mol. Its IUPAC name is 3-bromo-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole.
| Compound Name | 3-bromo-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 12649248 |
| Molecular Formula | C4H2BrN7O2 |
| Molecular Weight | 260.01 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 3-bromo-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(-n2cnc(Br)n2)n[nH]1 |
| InChI | InChI=1S/C4H2BrN7O2/c5-2-6-1-11(10-2)3-7-4(9-8-3)12(13)14/h1H,(H,7,8,9) |
| InChIKey | IQBZCQBIJVBEDH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.01 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|