C34H18F8O2 — CID 126492825
3-methoxy-6-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene (PubChem CID 126492825) has the molecular formula C34H18F8O2 and a molecular weight of 610.50 g/mol. Its IUPAC name is 3-methoxy-6-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene.
| Compound Name | 3-methoxy-6-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 126492825 |
| Molecular Formula | C34H18F8O2 |
| Molecular Weight | 610.50 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 3-methoxy-6-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenoxy]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
| SMILES | COc1ccc(Oc2c(F)c(F)c(-c3c(F)c(F)c(C)c(F)c3F)c(F)c2F)c2c1C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C34H18F8O2/c1-13-26(35)28(37)24(29(38)27(13)36)25-30(39)32(41)34(33(42)31(25)40)44-19-12-11-18(43-2)22-20-14-7-3-5-9-16(14)21(23(19)22)17-10-6-4-8-15(17)20/h3-12,20-21H,1-2H3 |
| InChIKey | KIURDSOOUJHXAS-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.50 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|