About N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide
N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide (PubChem CID 126493606) has the molecular formula C10H13N3O3S
and a molecular weight of 255.30 g/mol. Its IUPAC name is N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide |
| PubChem CID | 126493606 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide |
| SMILES | C=C/C(=C\C)NC(=O)c1cc(S(N)(=O)=O)c[nH]1 |
| InChI | InChI=1S/C10H13N3O3S/c1-3-7(4-2)13-10(14)9-5-8(6-12-9)17(11,15)16/h3-6,12H,1H2,2H3,(H,13,14)(H2,11,15,16)/b7-4+ |
| InChIKey | ZCOARQZAFVHWFF-QPJJXVBHSA-N |
| XLogP | 0.48 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide?
The IUPAC name of N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide (CID 126493606) is N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide.
What is the SMILES notation for N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide?
The canonical SMILES for N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide is C=C/C(=C\C)NC(=O)c1cc(S(N)(=O)=O)c[nH]1.
What is the InChIKey of N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide?
The InChIKey is ZCOARQZAFVHWFF-QPJJXVBHSA-N. The full InChI is InChI=1S/C10H13N3O3S/c1-3-7(4-2)13-10(14)9-5-8(6-12-9)17(11,15)16/h3-6,12H,1H2,2H3,(H,13,14)(H2,11,15,16)/b7-4+.
What are the key properties of N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide?
N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide has a molecular weight of 255.30 g/mol, XLogP of 0.48, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-penta-1,3-dien-3-yl]-4-sulfamoyl-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 126493606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).